C22H32N6O5S — CID 142072839
3-(3-cyclopentyl-2-methyl-8-oxo-3,7-dihydro-[1,2,4]triazolo[3,4-f][1,2,4]triazin-6-yl)-4-ethoxy-N-(1-hydroxybutan-2-yl)benzenesulfonamide (PubChem CID 142072839) has the molecular formula C22H32N6O5S and a molecular weight of 492.60 g/mol. Its IUPAC name is 3-(3-cyclopentyl-2-methyl-8-oxo-3,7-dihydro-[1,2,4]triazolo[3,4-f][1,2,4]triazin-6-yl)-4-ethoxy-N-(1-hydroxybutan-2-yl)benzenesulfonamide.
| Compound Name | 3-(3-cyclopentyl-2-methyl-8-oxo-3,7-dihydro-[1,2,4]triazolo[3,4-f][1,2,4]triazin-6-yl)-4-ethoxy-N-(1-hydroxybutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 142072839 |
| Molecular Formula | C22H32N6O5S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 3-(3-cyclopentyl-2-methyl-8-oxo-3,7-dihydro-[1,2,4]triazolo[3,4-f][1,2,4]triazin-6-yl)-4-ethoxy-N-(1-hydroxybutan-2-yl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC(CC)CO)cc1C1=NN2C(=NN(C)C2C2CCCC2)C(=O)N1 |
| InChI | InChI=1S/C22H32N6O5S/c1-4-15(13-29)26-34(31,32)16-10-11-18(33-5-2)17(12-16)19-23-21(30)20-25-27(3)22(28(20)24-19)14-8-6-7-9-14/h10-12,14-15,22,26,29H,4-9,13H2,1-3H3,(H,23,24,30) |
| InChIKey | AYUWDWNEOIXCOI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 135.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |