C16H23NO5 — CID 142074874
N-(2,5-dioxohexan-3-yl)-2-(4-hydroxyphenoxy)acetamide;ethane (PubChem CID 142074874) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is N-(2,5-dioxohexan-3-yl)-2-(4-hydroxyphenoxy)acetamide;ethane.
| Compound Name | N-(2,5-dioxohexan-3-yl)-2-(4-hydroxyphenoxy)acetamide;ethane |
|---|---|
| PubChem CID | 142074874 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | N-(2,5-dioxohexan-3-yl)-2-(4-hydroxyphenoxy)acetamide;ethane |
| SMILES | CC.CC(=O)CC(NC(=O)COc1ccc(O)cc1)C(C)=O |
| InChI | InChI=1S/C14H17NO5.C2H6/c1-9(16)7-13(10(2)17)15-14(19)8-20-12-5-3-11(18)4-6-12;1-2/h3-6,13,18H,7-8H2,1-2H3,(H,15,19);1-2H3 |
| InChIKey | QNVULBKAVAJGBK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |