C19H30N2 — CID 142074931
ethane;(3Z,6Z)-1-N-ethenyl-3,6-di(ethylidene)-2-N-[(Z)-prop-1-enyl]cyclohex-4-ene-1,2-diimine (PubChem CID 142074931) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is ethane;(3Z,6Z)-1-N-ethenyl-3,6-di(ethylidene)-2-N-[(Z)-prop-1-enyl]cyclohex-4-ene-1,2-diimine.
| Compound Name | ethane;(3Z,6Z)-1-N-ethenyl-3,6-di(ethylidene)-2-N-[(Z)-prop-1-enyl]cyclohex-4-ene-1,2-diimine |
|---|---|
| PubChem CID | 142074931 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | ethane;(3Z,6Z)-1-N-ethenyl-3,6-di(ethylidene)-2-N-[(Z)-prop-1-enyl]cyclohex-4-ene-1,2-diimine |
| SMILES | C=C/N=C1/C(=C\C)/C=CC(=C/C)/C1=N\C=C/C.CC.CC |
| InChI | InChI=1S/C15H18N2.2C2H6/c1-5-11-17-15-13(7-3)10-9-12(6-2)14(15)16-8-4;2*1-2/h5-11H,4H2,1-3H3;2*1-2H3/b11-5-,12-6-,13-7-,16-14-,17-15+;; |
| InChIKey | AOPJMFAWXATQME-AFCNFWDSSA-N |
| XLogP | 6.06 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|