C18H28S — CID 142075092
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,3,4-trimethyl-5-methylidenethiophene (PubChem CID 142075092) has the molecular formula C18H28S and a molecular weight of 276.49 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,3,4-trimethyl-5-methylidenethiophene.
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,3,4-trimethyl-5-methylidenethiophene |
|---|---|
| PubChem CID | 142075092 |
| Molecular Formula | C18H28S |
| Molecular Weight | 276.49 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,3,4-trimethyl-5-methylidenethiophene |
| SMILES | C=C1SC(C)(C/C=C(\C)CCC=C(C)C)C(C)=C1C |
| InChI | InChI=1S/C18H28S/c1-13(2)9-8-10-14(3)11-12-18(7)16(5)15(4)17(6)19-18/h9,11H,6,8,10,12H2,1-5,7H3/b14-11+ |
| InChIKey | FEOXHYRKRHVWDV-SDNWHVSQSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.49 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|