C19H32S — CID 142075102
2,3,4-trimethyl-5-methylidene-2-(3,3,7-trimethyloct-6-enyl)thiophene (PubChem CID 142075102) has the molecular formula C19H32S and a molecular weight of 292.53 g/mol. Its IUPAC name is 2,3,4-trimethyl-5-methylidene-2-(3,3,7-trimethyloct-6-enyl)thiophene.
| Compound Name | 2,3,4-trimethyl-5-methylidene-2-(3,3,7-trimethyloct-6-enyl)thiophene |
|---|---|
| PubChem CID | 142075102 |
| Molecular Formula | C19H32S |
| Molecular Weight | 292.53 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 2,3,4-trimethyl-5-methylidene-2-(3,3,7-trimethyloct-6-enyl)thiophene |
| SMILES | C=C1SC(C)(CCC(C)(C)CCC=C(C)C)C(C)=C1C |
| InChI | InChI=1S/C19H32S/c1-14(2)10-9-11-18(6,7)12-13-19(8)16(4)15(3)17(5)20-19/h10H,5,9,11-13H2,1-4,6-8H3 |
| InChIKey | ICBDKSWAUSHYJU-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.53 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|