About 1-(2-aminopropanoyl)pyrrolidine-2-carboxamide;4-nitrobenzoic acid
1-(2-aminopropanoyl)pyrrolidine-2-carboxamide;4-nitrobenzoic acid (PubChem CID 142076307) has the molecular formula C15H20N4O6
and a molecular weight of 352.35 g/mol. Its IUPAC name is 1-(2-aminopropanoyl)pyrrolidine-2-carboxamide;4-nitrobenzoic acid.
Molecular Properties
| Compound Name | 1-(2-aminopropanoyl)pyrrolidine-2-carboxamide;4-nitrobenzoic acid |
| PubChem CID | 142076307 |
| Molecular Formula | C15H20N4O6 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1-(2-aminopropanoyl)pyrrolidine-2-carboxamide;4-nitrobenzoic acid |
| SMILES | CC(N)C(=O)N1CCCC1C(N)=O.O=C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C8H15N3O2.C7H5NO4/c1-5(9)8(13)11-4-2-3-6(11)7(10)12;9-7(10)5-1-3-6(4-2-5)8(11)12/h5-6H,2-4,9H2,1H3,(H2,10,12);1-4H,(H,9,10) |
| InChIKey | HLCMRPRHZMYTCE-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 169.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-aminopropanoyl)pyrrolidine-2-carboxamide;4-nitrobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminopropanoyl)pyrrolidine-2-carboxamide;4-nitrobenzoic acid?
The IUPAC name of 1-(2-aminopropanoyl)pyrrolidine-2-carboxamide;4-nitrobenzoic acid (CID 142076307) is 1-(2-aminopropanoyl)pyrrolidine-2-carboxamide;4-nitrobenzoic acid.
What is the SMILES notation for 1-(2-aminopropanoyl)pyrrolidine-2-carboxamide;4-nitrobenzoic acid?
The canonical SMILES for 1-(2-aminopropanoyl)pyrrolidine-2-carboxamide;4-nitrobenzoic acid is CC(N)C(=O)N1CCCC1C(N)=O.O=C(O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 1-(2-aminopropanoyl)pyrrolidine-2-carboxamide;4-nitrobenzoic acid?
The InChIKey is HLCMRPRHZMYTCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O2.C7H5NO4/c1-5(9)8(13)11-4-2-3-6(11)7(10)12;9-7(10)5-1-3-6(4-2-5)8(11)12/h5-6H,2-4,9H2,1H3,(H2,10,12);1-4H,(H,9,10).
What are the key properties of 1-(2-aminopropanoyl)pyrrolidine-2-carboxamide;4-nitrobenzoic acid?
1-(2-aminopropanoyl)pyrrolidine-2-carboxamide;4-nitrobenzoic acid has a molecular weight of 352.35 g/mol, XLogP of 0.10, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminopropanoyl)pyrrolidine-2-carboxamide;4-nitrobenzoic acid is sourced from PubChem (CID 142076307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).