C8H12N2 — CID 142076318
4,6-dimethyl-4H-azepin-7-amine (PubChem CID 142076318) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 4,6-dimethyl-4H-azepin-7-amine.
| Compound Name | 4,6-dimethyl-4H-azepin-7-amine |
|---|---|
| PubChem CID | 142076318 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 4,6-dimethyl-4H-azepin-7-amine |
| SMILES | CC1=CC(C)C=CN=C1N |
| InChI | InChI=1S/C8H12N2/c1-6-3-4-10-8(9)7(2)5-6/h3-6H,1-2H3,(H2,9,10) |
| InChIKey | WXPYTXOINPLWNL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |