About 2-amino-3-[(dimethylamino)methyl]pentanal;methanamine
2-amino-3-[(dimethylamino)methyl]pentanal;methanamine (PubChem CID 142076811) has the molecular formula C9H23N3O
and a molecular weight of 189.30 g/mol. Its IUPAC name is 2-amino-3-[(dimethylamino)methyl]pentanal;methanamine.
Molecular Properties
| Compound Name | 2-amino-3-[(dimethylamino)methyl]pentanal;methanamine |
| PubChem CID | 142076811 |
| Molecular Formula | C9H23N3O |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.18 |
| IUPAC Name | 2-amino-3-[(dimethylamino)methyl]pentanal;methanamine |
| SMILES | CCC(CN(C)C)C(N)C=O.CN |
| InChI | InChI=1S/C8H18N2O.CH5N/c1-4-7(5-10(2)3)8(9)6-11;1-2/h6-8H,4-5,9H2,1-3H3;2H2,1H3 |
| InChIKey | CGKVDQMMTPPBGX-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-[(dimethylamino)methyl]pentanal;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[(dimethylamino)methyl]pentanal;methanamine?
The IUPAC name of 2-amino-3-[(dimethylamino)methyl]pentanal;methanamine (CID 142076811) is 2-amino-3-[(dimethylamino)methyl]pentanal;methanamine.
What is the SMILES notation for 2-amino-3-[(dimethylamino)methyl]pentanal;methanamine?
The canonical SMILES for 2-amino-3-[(dimethylamino)methyl]pentanal;methanamine is CCC(CN(C)C)C(N)C=O.CN.
What is the InChIKey of 2-amino-3-[(dimethylamino)methyl]pentanal;methanamine?
The InChIKey is CGKVDQMMTPPBGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O.CH5N/c1-4-7(5-10(2)3)8(9)6-11;1-2/h6-8H,4-5,9H2,1-3H3;2H2,1H3.
What are the key properties of 2-amino-3-[(dimethylamino)methyl]pentanal;methanamine?
2-amino-3-[(dimethylamino)methyl]pentanal;methanamine has a molecular weight of 189.30 g/mol, XLogP of -0.32, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[(dimethylamino)methyl]pentanal;methanamine is sourced from PubChem (CID 142076811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).