C7H20N2O3 — CID 174691520
1-aminopropan-1-ol;N,N-dimethylmethanamine;formic acid (PubChem CID 174691520) has the molecular formula C7H20N2O3 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-aminopropan-1-ol;N,N-dimethylmethanamine;formic acid.
| Compound Name | 1-aminopropan-1-ol;N,N-dimethylmethanamine;formic acid |
|---|---|
| PubChem CID | 174691520 |
| Molecular Formula | C7H20N2O3 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 1-aminopropan-1-ol;N,N-dimethylmethanamine;formic acid |
| SMILES | CCC(N)O.CN(C)C.O=CO |
| InChI | InChI=1S/C3H9NO.C3H9N.CH2O2/c1-2-3(4)5;1-4(2)3;2-1-3/h3,5H,2,4H2,1H3;1-3H3;1H,(H,2,3) |
| InChIKey | NWMMXBVXZLFZCM-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|