C8H15NO3 — CID 89046836
(E,4R,5S,6R)-6-amino-4,5-dihydroxyoct-2-enal (PubChem CID 89046836) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is (E,4R,5S,6R)-6-amino-4,5-dihydroxyoct-2-enal.
| Compound Name | (E,4R,5S,6R)-6-amino-4,5-dihydroxyoct-2-enal |
|---|---|
| PubChem CID | 89046836 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | (E,4R,5S,6R)-6-amino-4,5-dihydroxyoct-2-enal |
| SMILES | CC[C@@H](N)[C@H](O)[C@H](O)/C=C/C=O |
| InChI | InChI=1S/C8H15NO3/c1-2-6(9)8(12)7(11)4-3-5-10/h3-8,11-12H,2,9H2,1H3/b4-3+/t6-,7-,8+/m1/s1 |
| InChIKey | YRXJEYJKIVPNHO-UAENDNOJSA-N |
| XLogP | -0.80 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|