C12H25NO5S — CID 174880943
5-(diethylamino)-4-hydroxypent-2-enal;propane-1-sulfonic acid (PubChem CID 174880943) has the molecular formula C12H25NO5S and a molecular weight of 295.40 g/mol. Its IUPAC name is 5-(diethylamino)-4-hydroxypent-2-enal;propane-1-sulfonic acid.
| Compound Name | 5-(diethylamino)-4-hydroxypent-2-enal;propane-1-sulfonic acid |
|---|---|
| PubChem CID | 174880943 |
| Molecular Formula | C12H25NO5S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 5-(diethylamino)-4-hydroxypent-2-enal;propane-1-sulfonic acid |
| SMILES | CCCS(=O)(=O)O.CCN(CC)CC(O)C=CC=O |
| InChI | InChI=1S/C9H17NO2.C3H8O3S/c1-3-10(4-2)8-9(12)6-5-7-11;1-2-3-7(4,5)6/h5-7,9,12H,3-4,8H2,1-2H3;2-3H2,1H3,(H,4,5,6) |
| InChIKey | LJTZHAZRMXLCPP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|