C19H30N2O2 — CID 142077549
9-(8-methyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-b]azepin-2-yl)nonanoic acid (PubChem CID 142077549) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 9-(8-methyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-b]azepin-2-yl)nonanoic acid.
| Compound Name | 9-(8-methyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-b]azepin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 142077549 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 9-(8-methyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-b]azepin-2-yl)nonanoic acid |
| SMILES | CC1CCCc2ccc(CCCCCCCCC(=O)O)nc2N1 |
| InChI | InChI=1S/C19H30N2O2/c1-15-9-8-10-16-13-14-17(21-19(16)20-15)11-6-4-2-3-5-7-12-18(22)23/h13-15H,2-12H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | CFFGWSPRCHGCQU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|