C22H31N5O3 — CID 142124946
2-methylpyrimidine;9-(7-nitroso-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 142124946) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 2-methylpyrimidine;9-(7-nitroso-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | 2-methylpyrimidine;9-(7-nitroso-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 142124946 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 2-methylpyrimidine;9-(7-nitroso-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | Cc1ncccn1.O=NC1CCc2ccc(CCCCCCCCC(=O)O)nc2N1 |
| InChI | InChI=1S/C17H25N3O3.C5H6N2/c21-16(22)8-6-4-2-1-3-5-7-14-11-9-13-10-12-15(20-23)19-17(13)18-14;1-5-6-3-2-4-7-5/h9,11,15H,1-8,10,12H2,(H,18,19)(H,21,22);2-4H,1H3 |
| InChIKey | FAUMVWMGHYDRCM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|