C23H30N4O3 — CID 70092198
(3R)-3-(2-methylpyrimidin-5-yl)-9-(6-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-5-oxononanoic acid (PubChem CID 70092198) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is (3R)-3-(2-methylpyrimidin-5-yl)-9-(6-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-5-oxononanoic acid.
| Compound Name | (3R)-3-(2-methylpyrimidin-5-yl)-9-(6-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-5-oxononanoic acid |
|---|---|
| PubChem CID | 70092198 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | (3R)-3-(2-methylpyrimidin-5-yl)-9-(6-methyl-5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-5-oxononanoic acid |
| SMILES | Cc1ncc([C@@H](CC(=O)O)CC(=O)CCCCc2ccc3c(n2)NCC(C)C3)cn1 |
| InChI | InChI=1S/C23H30N4O3/c1-15-9-17-7-8-20(27-23(17)26-12-15)5-3-4-6-21(28)10-18(11-22(29)30)19-13-24-16(2)25-14-19/h7-8,13-15,18H,3-6,9-12H2,1-2H3,(H,26,27)(H,29,30)/t15?,18-/m1/s1 |
| InChIKey | RWGYKDBFESDGHI-KPMSDPLLSA-N |
| XLogP | 3.71 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|