C24H23Cl2NO2 — CID 142077908
[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl] carbonochloridate;ethene (PubChem CID 142077908) has the molecular formula C24H23Cl2NO2 and a molecular weight of 428.36 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl] carbonochloridate;ethene.
| Compound Name | [2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl] carbonochloridate;ethene |
|---|---|
| PubChem CID | 142077908 |
| Molecular Formula | C24H23Cl2NO2 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | [2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl] carbonochloridate;ethene |
| SMILES | C=C.CC1(C)Cc2c(-c3ccccc3)c(-c3ccc(Cl)cc3)c(OC(=O)Cl)n2C1 |
| InChI | InChI=1S/C22H19Cl2NO2.C2H4/c1-22(2)12-17-18(14-6-4-3-5-7-14)19(15-8-10-16(23)11-9-15)20(25(17)13-22)27-21(24)26;1-2/h3-11H,12-13H2,1-2H3;1-2H2 |
| InChIKey | DYEJWQVVGGHJFP-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|