C28H36ClN2O3+ — CID 67016397
2-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid;2-hydroxyethyl(trimethyl)azanium (PubChem CID 67016397) has the molecular formula C28H36ClN2O3+ and a molecular weight of 484.06 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid;2-hydroxyethyl(trimethyl)azanium.
| Compound Name | 2-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid;2-hydroxyethyl(trimethyl)azanium |
|---|---|
| PubChem CID | 67016397 |
| Molecular Formula | C28H36ClN2O3+ |
| Molecular Weight | 484.06 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-6,6-dimethyl-1-phenyl-5,7-dihydropyrrolizin-3-yl]acetic acid;2-hydroxyethyl(trimethyl)azanium |
| SMILES | CC1(C)Cc2c(-c3ccccc3)c(-c3ccc(Cl)cc3)c(CC(=O)O)n2C1.C[N+](C)(C)CCO |
| InChI | InChI=1S/C23H22ClNO2.C5H14NO/c1-23(2)13-19-22(15-6-4-3-5-7-15)21(16-8-10-17(24)11-9-16)18(12-20(26)27)25(19)14-23;1-6(2,3)4-5-7/h3-11H,12-14H2,1-2H3,(H,26,27);7H,4-5H2,1-3H3/q;+1 |
| InChIKey | FMTJEWMNEIHXRC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.06 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|