C30H41FN6O2 — CID 142078216
1-[(3E,5Z)-5-[[1-[4-(4-acetylpiperazin-1-yl)anilino]ethylideneamino]methylidene]-3-fluoro-6-methylhepta-1,3,6-trien-2-yl]-3-cyclohexylurea (PubChem CID 142078216) has the molecular formula C30H41FN6O2 and a molecular weight of 536.70 g/mol. Its IUPAC name is 1-[(3E,5Z)-5-[[1-[4-(4-acetylpiperazin-1-yl)anilino]ethylideneamino]methylidene]-3-fluoro-6-methylhepta-1,3,6-trien-2-yl]-3-cyclohexylurea.
| Compound Name | 1-[(3E,5Z)-5-[[1-[4-(4-acetylpiperazin-1-yl)anilino]ethylideneamino]methylidene]-3-fluoro-6-methylhepta-1,3,6-trien-2-yl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 142078216 |
| Molecular Formula | C30H41FN6O2 |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | 1-[(3E,5Z)-5-[[1-[4-(4-acetylpiperazin-1-yl)anilino]ethylideneamino]methylidene]-3-fluoro-6-methylhepta-1,3,6-trien-2-yl]-3-cyclohexylurea |
| SMILES | C=C(C)C(=C\N=C(/C)Nc1ccc(N2CCN(C(C)=O)CC2)cc1)/C=C(/F)C(=C)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C30H41FN6O2/c1-21(2)25(19-29(31)22(3)33-30(39)35-26-9-7-6-8-10-26)20-32-23(4)34-27-11-13-28(14-12-27)37-17-15-36(16-18-37)24(5)38/h11-14,19-20,26H,1,3,6-10,15-18H2,2,4-5H3,(H,32,34)(H2,33,35,39)/b25-20-,29-19+ |
| InChIKey | UNNAQURFRNELDQ-POFIWWKSSA-N |
| XLogP | 5.64 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|