C21H20FN4O2S+ — CID 142079966
1-(3-azoniatricyclo[4.2.0.01,3]octan-7-yl)-3-[6-(4-fluorophenoxy)-1,3-benzothiazol-2-yl]urea (PubChem CID 142079966) has the molecular formula C21H20FN4O2S+ and a molecular weight of 411.48 g/mol. Its IUPAC name is 1-(3-azoniatricyclo[4.2.0.01,3]octan-7-yl)-3-[6-(4-fluorophenoxy)-1,3-benzothiazol-2-yl]urea.
| Compound Name | 1-(3-azoniatricyclo[4.2.0.01,3]octan-7-yl)-3-[6-(4-fluorophenoxy)-1,3-benzothiazol-2-yl]urea |
|---|---|
| PubChem CID | 142079966 |
| Molecular Formula | C21H20FN4O2S+ |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 1-(3-azoniatricyclo[4.2.0.01,3]octan-7-yl)-3-[6-(4-fluorophenoxy)-1,3-benzothiazol-2-yl]urea |
| SMILES | O=C(Nc1nc2ccc(Oc3ccc(F)cc3)cc2s1)NC1CC23C[NH+]2CCC13 |
| InChI | InChI=1S/C21H19FN4O2S/c22-12-1-3-13(4-2-12)28-14-5-6-16-18(9-14)29-20(24-16)25-19(27)23-17-10-21-11-26(21)8-7-15(17)21/h1-6,9,15,17H,7-8,10-11H2,(H2,23,24,25,27)/p+1 |
| InChIKey | PEIQIYIQAXJBJX-UHFFFAOYSA-O |
| XLogP | 2.78 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|