C11H20O2 — CID 142081177
[(3aR,7aR)-7,7-dimethyl-2,3,3a,4,5,6-hexahydro-1-benzofuran-7a-yl]methanol (PubChem CID 142081177) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is [(3aR,7aR)-7,7-dimethyl-2,3,3a,4,5,6-hexahydro-1-benzofuran-7a-yl]methanol.
| Compound Name | [(3aR,7aR)-7,7-dimethyl-2,3,3a,4,5,6-hexahydro-1-benzofuran-7a-yl]methanol |
|---|---|
| PubChem CID | 142081177 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | [(3aR,7aR)-7,7-dimethyl-2,3,3a,4,5,6-hexahydro-1-benzofuran-7a-yl]methanol |
| SMILES | CC1(C)CCC[C@@H]2CCO[C@]21CO |
| InChI | InChI=1S/C11H20O2/c1-10(2)6-3-4-9-5-7-13-11(9,10)8-12/h9,12H,3-8H2,1-2H3/t9-,11-/m1/s1 |
| InChIKey | XRWUDNNZENPYGJ-MWLCHTKSSA-N |
| XLogP | 1.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |