C17H25Cl2NO — CID 142084166
2-chloro-N-[1-(4-chlorophenyl)ethyl]-1,2,3-trimethylcyclopropane-1-carboxamide;ethane (PubChem CID 142084166) has the molecular formula C17H25Cl2NO and a molecular weight of 330.30 g/mol. Its IUPAC name is 2-chloro-N-[1-(4-chlorophenyl)ethyl]-1,2,3-trimethylcyclopropane-1-carboxamide;ethane.
| Compound Name | 2-chloro-N-[1-(4-chlorophenyl)ethyl]-1,2,3-trimethylcyclopropane-1-carboxamide;ethane |
|---|---|
| PubChem CID | 142084166 |
| Molecular Formula | C17H25Cl2NO |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-chloro-N-[1-(4-chlorophenyl)ethyl]-1,2,3-trimethylcyclopropane-1-carboxamide;ethane |
| SMILES | CC.CC(NC(=O)C1(C)C(C)C1(C)Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H19Cl2NO.C2H6/c1-9(11-5-7-12(16)8-6-11)18-13(19)14(3)10(2)15(14,4)17;1-2/h5-10H,1-4H3,(H,18,19);1-2H3 |
| InChIKey | DMHZIHXRSNBMHG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|