C32H44N6O2 — CID 142084816
5-cyclohexyl-N-(4,5,6,7-tetrahydro-3H-benzimidazol-5-yl)pentanamide;N-phenyl-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxamide (PubChem CID 142084816) has the molecular formula C32H44N6O2 and a molecular weight of 544.74 g/mol. Its IUPAC name is 5-cyclohexyl-N-(4,5,6,7-tetrahydro-3H-benzimidazol-5-yl)pentanamide;N-phenyl-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxamide.
| Compound Name | 5-cyclohexyl-N-(4,5,6,7-tetrahydro-3H-benzimidazol-5-yl)pentanamide;N-phenyl-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 142084816 |
| Molecular Formula | C32H44N6O2 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.35 |
| IUPAC Name | 5-cyclohexyl-N-(4,5,6,7-tetrahydro-3H-benzimidazol-5-yl)pentanamide;N-phenyl-4,5,6,7-tetrahydro-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(CCCCC1CCCCC1)NC1CCc2nc[nH]c2C1.O=C(Nc1ccccc1)C1CCc2nc[nH]c2C1 |
| InChI | InChI=1S/C18H29N3O.C14H15N3O/c22-18(9-5-4-8-14-6-2-1-3-7-14)21-15-10-11-16-17(12-15)20-13-19-16;18-14(17-11-4-2-1-3-5-11)10-6-7-12-13(8-10)16-9-15-12/h13-15H,1-12H2,(H,19,20)(H,21,22);1-5,9-10H,6-8H2,(H,15,16)(H,17,18) |
| InChIKey | FQTCDVXSLSKEMT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|