C16H32 — CID 142085389
1-(2,3-dimethylbutan-2-yl)-3-prop-1-en-2-ylcyclohexane;methane (PubChem CID 142085389) has the molecular formula C16H32 and a molecular weight of 224.43 g/mol. Its IUPAC name is 1-(2,3-dimethylbutan-2-yl)-3-prop-1-en-2-ylcyclohexane;methane.
| Compound Name | 1-(2,3-dimethylbutan-2-yl)-3-prop-1-en-2-ylcyclohexane;methane |
|---|---|
| PubChem CID | 142085389 |
| Molecular Formula | C16H32 |
| Molecular Weight | 224.43 g/mol |
| Exact Mass | 224.25 |
| IUPAC Name | 1-(2,3-dimethylbutan-2-yl)-3-prop-1-en-2-ylcyclohexane;methane |
| SMILES | C.C=C(C)C1CCCC(C(C)(C)C(C)C)C1 |
| InChI | InChI=1S/C15H28.CH4/c1-11(2)13-8-7-9-14(10-13)15(5,6)12(3)4;/h12-14H,1,7-10H2,2-6H3;1H4 |
| InChIKey | CVYCFYLHDXSREA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.43 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|