C24H26F2O7P2S — CID 142085945
[5-[4-[[4-[difluoro(phosphono)methyl]phenyl]methylsulfanylmethyl]phenyl]-2-propoxyphenyl]phosphonic acid (PubChem CID 142085945) has the molecular formula C24H26F2O7P2S and a molecular weight of 558.48 g/mol. Its IUPAC name is [5-[4-[[4-[difluoro(phosphono)methyl]phenyl]methylsulfanylmethyl]phenyl]-2-propoxyphenyl]phosphonic acid.
| Compound Name | [5-[4-[[4-[difluoro(phosphono)methyl]phenyl]methylsulfanylmethyl]phenyl]-2-propoxyphenyl]phosphonic acid |
|---|---|
| PubChem CID | 142085945 |
| Molecular Formula | C24H26F2O7P2S |
| Molecular Weight | 558.48 g/mol |
| Exact Mass | 558.08 |
| IUPAC Name | [5-[4-[[4-[difluoro(phosphono)methyl]phenyl]methylsulfanylmethyl]phenyl]-2-propoxyphenyl]phosphonic acid |
| SMILES | CCCOc1ccc(-c2ccc(CSCc3ccc(C(F)(F)P(=O)(O)O)cc3)cc2)cc1P(=O)(O)O |
| InChI | InChI=1S/C24H26F2O7P2S/c1-2-13-33-22-12-9-20(14-23(22)34(27,28)29)19-7-3-17(4-8-19)15-36-16-18-5-10-21(11-6-18)24(25,26)35(30,31)32/h3-12,14H,2,13,15-16H2,1H3,(H2,27,28,29)(H2,30,31,32) |
| InChIKey | SKSXHNAHTCRCLG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|