C27H24F2O6P2S — CID 10281621
[difluoro-[4-[[4-(4-phenyl-3-phosphonophenyl)phenyl]methylsulfanylmethyl]phenyl]methyl]phosphonic acid (PubChem CID 10281621) has the molecular formula C27H24F2O6P2S and a molecular weight of 576.49 g/mol. Its IUPAC name is [difluoro-[4-[[4-(4-phenyl-3-phosphonophenyl)phenyl]methylsulfanylmethyl]phenyl]methyl]phosphonic acid.
| Compound Name | [difluoro-[4-[[4-(4-phenyl-3-phosphonophenyl)phenyl]methylsulfanylmethyl]phenyl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 10281621 |
| Molecular Formula | C27H24F2O6P2S |
| Molecular Weight | 576.49 g/mol |
| Exact Mass | 576.07 |
| IUPAC Name | [difluoro-[4-[[4-(4-phenyl-3-phosphonophenyl)phenyl]methylsulfanylmethyl]phenyl]methyl]phosphonic acid |
| SMILES | O=P(O)(O)c1cc(-c2ccc(CSCc3ccc(C(F)(F)P(=O)(O)O)cc3)cc2)ccc1-c1ccccc1 |
| InChI | InChI=1S/C27H24F2O6P2S/c28-27(29,37(33,34)35)24-13-8-20(9-14-24)18-38-17-19-6-10-21(11-7-19)23-12-15-25(22-4-2-1-3-5-22)26(16-23)36(30,31)32/h1-16H,17-18H2,(H2,30,31,32)(H2,33,34,35) |
| InChIKey | GLJVAEUMQMNUTK-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.49 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|