C24H35Br2N2O2+ — CID 142086244
[3,5-dibromo-4-[(3-ethyl-1H-indol-5-yl)oxy]phenyl]-methoxyazanium;ethane;pentane (PubChem CID 142086244) has the molecular formula C24H35Br2N2O2+ and a molecular weight of 543.36 g/mol. Its IUPAC name is [3,5-dibromo-4-[(3-ethyl-1H-indol-5-yl)oxy]phenyl]-methoxyazanium;ethane;pentane.
| Compound Name | [3,5-dibromo-4-[(3-ethyl-1H-indol-5-yl)oxy]phenyl]-methoxyazanium;ethane;pentane |
|---|---|
| PubChem CID | 142086244 |
| Molecular Formula | C24H35Br2N2O2+ |
| Molecular Weight | 543.36 g/mol |
| Exact Mass | 541.11 |
| IUPAC Name | [3,5-dibromo-4-[(3-ethyl-1H-indol-5-yl)oxy]phenyl]-methoxyazanium;ethane;pentane |
| SMILES | CC.CCCCC.CCc1c[nH]c2ccc(Oc3c(Br)cc([NH2+]OC)cc3Br)cc12 |
| InChI | InChI=1S/C17H16Br2N2O2.C5H12.C2H6/c1-3-10-9-20-16-5-4-12(8-13(10)16)23-17-14(18)6-11(21-22-2)7-15(17)19;1-3-5-4-2;1-2/h4-9,20-21H,3H2,1-2H3;3-5H2,1-2H3;1-2H3/p+1 |
| InChIKey | PABNJGXEGXKEJY-UHFFFAOYSA-O |
| XLogP | 8.03 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.36 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|