C21H24Br2N2O — CID 91803945
3,5-dibromo-N-ethyl-4-[(3-pentyl-1H-indol-5-yl)oxy]aniline (PubChem CID 91803945) has the molecular formula C21H24Br2N2O and a molecular weight of 480.24 g/mol. Its IUPAC name is 3,5-dibromo-N-ethyl-4-[(3-pentyl-1H-indol-5-yl)oxy]aniline.
| Compound Name | 3,5-dibromo-N-ethyl-4-[(3-pentyl-1H-indol-5-yl)oxy]aniline |
|---|---|
| PubChem CID | 91803945 |
| Molecular Formula | C21H24Br2N2O |
| Molecular Weight | 480.24 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | 3,5-dibromo-N-ethyl-4-[(3-pentyl-1H-indol-5-yl)oxy]aniline |
| SMILES | CCCCCc1c[nH]c2ccc(Oc3c(Br)cc(NCC)cc3Br)cc12 |
| InChI | InChI=1S/C21H24Br2N2O/c1-3-5-6-7-14-13-25-20-9-8-16(12-17(14)20)26-21-18(22)10-15(24-4-2)11-19(21)23/h8-13,24-25H,3-7H2,1-2H3 |
| InChIKey | BZDDXCTUGBJNMQ-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.24 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|