C24H26F3NO3 — CID 22669793
2-[4-[(3-hexyl-1H-indol-5-yl)oxy]-3-methyl-5-(trifluoromethyl)phenyl]acetic acid (PubChem CID 22669793) has the molecular formula C24H26F3NO3 and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-[4-[(3-hexyl-1H-indol-5-yl)oxy]-3-methyl-5-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-[4-[(3-hexyl-1H-indol-5-yl)oxy]-3-methyl-5-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 22669793 |
| Molecular Formula | C24H26F3NO3 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 2-[4-[(3-hexyl-1H-indol-5-yl)oxy]-3-methyl-5-(trifluoromethyl)phenyl]acetic acid |
| SMILES | CCCCCCc1c[nH]c2ccc(Oc3c(C)cc(CC(=O)O)cc3C(F)(F)F)cc12 |
| InChI | InChI=1S/C24H26F3NO3/c1-3-4-5-6-7-17-14-28-21-9-8-18(13-19(17)21)31-23-15(2)10-16(12-22(29)30)11-20(23)24(25,26)27/h8-11,13-14,28H,3-7,12H2,1-2H3,(H,29,30) |
| InChIKey | DHBHVKKEFOFMML-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|