C22H22F3NO4 — CID 22669847
2-[4-[(3-butan-2-yl-1H-indol-5-yl)oxy]-3-methyl-5-(trifluoromethyl)phenoxy]acetic acid (PubChem CID 22669847) has the molecular formula C22H22F3NO4 and a molecular weight of 421.42 g/mol. Its IUPAC name is 2-[4-[(3-butan-2-yl-1H-indol-5-yl)oxy]-3-methyl-5-(trifluoromethyl)phenoxy]acetic acid.
| Compound Name | 2-[4-[(3-butan-2-yl-1H-indol-5-yl)oxy]-3-methyl-5-(trifluoromethyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 22669847 |
| Molecular Formula | C22H22F3NO4 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 2-[4-[(3-butan-2-yl-1H-indol-5-yl)oxy]-3-methyl-5-(trifluoromethyl)phenoxy]acetic acid |
| SMILES | CCC(C)c1c[nH]c2ccc(Oc3c(C)cc(OCC(=O)O)cc3C(F)(F)F)cc12 |
| InChI | InChI=1S/C22H22F3NO4/c1-4-12(2)17-10-26-19-6-5-14(8-16(17)19)30-21-13(3)7-15(29-11-20(27)28)9-18(21)22(23,24)25/h5-10,12,26H,4,11H2,1-3H3,(H,27,28) |
| InChIKey | KOSLLNFKGBNJDG-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |