C21H22ClNO4 — CID 22669547
2-[4-[(3-butyl-1H-indol-5-yl)oxy]-3-chloro-5-methylphenoxy]acetic acid (PubChem CID 22669547) has the molecular formula C21H22ClNO4 and a molecular weight of 387.86 g/mol. Its IUPAC name is 2-[4-[(3-butyl-1H-indol-5-yl)oxy]-3-chloro-5-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[(3-butyl-1H-indol-5-yl)oxy]-3-chloro-5-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 22669547 |
| Molecular Formula | C21H22ClNO4 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 2-[4-[(3-butyl-1H-indol-5-yl)oxy]-3-chloro-5-methylphenoxy]acetic acid |
| SMILES | CCCCc1c[nH]c2ccc(Oc3c(C)cc(OCC(=O)O)cc3Cl)cc12 |
| InChI | InChI=1S/C21H22ClNO4/c1-3-4-5-14-11-23-19-7-6-15(9-17(14)19)27-21-13(2)8-16(10-18(21)22)26-12-20(24)25/h6-11,23H,3-5,12H2,1-2H3,(H,24,25) |
| InChIKey | IMKIWEFNNFFFOM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |