C18H19Br2N3O4 — CID 142086307
N'-[3,5-dibromo-4-[3-methyl-4-(methylamino)phenoxy]phenyl]-N-(2-hydroxyethyl)oxamide (PubChem CID 142086307) has the molecular formula C18H19Br2N3O4 and a molecular weight of 501.18 g/mol. Its IUPAC name is N'-[3,5-dibromo-4-[3-methyl-4-(methylamino)phenoxy]phenyl]-N-(2-hydroxyethyl)oxamide.
| Compound Name | N'-[3,5-dibromo-4-[3-methyl-4-(methylamino)phenoxy]phenyl]-N-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 142086307 |
| Molecular Formula | C18H19Br2N3O4 |
| Molecular Weight | 501.18 g/mol |
| Exact Mass | 498.97 |
| IUPAC Name | N'-[3,5-dibromo-4-[3-methyl-4-(methylamino)phenoxy]phenyl]-N-(2-hydroxyethyl)oxamide |
| SMILES | CNc1ccc(Oc2c(Br)cc(NC(=O)C(=O)NCCO)cc2Br)cc1C |
| InChI | InChI=1S/C18H19Br2N3O4/c1-10-7-12(3-4-15(10)21-2)27-16-13(19)8-11(9-14(16)20)23-18(26)17(25)22-5-6-24/h3-4,7-9,21,24H,5-6H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | PEKPGJBABYYYAT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.18 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|