C16H20N4O2S — CID 142087710
2-[3-[(Z)-N-ethoxy-C-methylcarbonimidoyl]phenyl]-N-(3-ethyl-1,2,4-thiadiazol-5-yl)acetamide (PubChem CID 142087710) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is 2-[3-[(Z)-N-ethoxy-C-methylcarbonimidoyl]phenyl]-N-(3-ethyl-1,2,4-thiadiazol-5-yl)acetamide.
| Compound Name | 2-[3-[(Z)-N-ethoxy-C-methylcarbonimidoyl]phenyl]-N-(3-ethyl-1,2,4-thiadiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 142087710 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-[3-[(Z)-N-ethoxy-C-methylcarbonimidoyl]phenyl]-N-(3-ethyl-1,2,4-thiadiazol-5-yl)acetamide |
| SMILES | CCO/N=C(/C)c1cccc(CC(=O)Nc2nc(CC)ns2)c1 |
| InChI | InChI=1S/C16H20N4O2S/c1-4-14-17-16(23-20-14)18-15(21)10-12-7-6-8-13(9-12)11(3)19-22-5-2/h6-9H,4-5,10H2,1-3H3,(H,17,18,20,21)/b19-11- |
| InChIKey | OUZYWYLXGYMJJN-ODLFYWEKSA-N |
| XLogP | 3.04 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|