C25H37NO4 — CID 14208878
1-adamantylmethyl 2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetate (PubChem CID 14208878) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is 1-adamantylmethyl 2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetate.
| Compound Name | 1-adamantylmethyl 2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetate |
|---|---|
| PubChem CID | 14208878 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | 1-adamantylmethyl 2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetate |
| SMILES | CC(C)NCC(O)COc1ccc(CC(=O)OCC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C25H37NO4/c1-17(2)26-14-22(27)15-29-23-5-3-18(4-6-23)10-24(28)30-16-25-11-19-7-20(12-25)9-21(8-19)13-25/h3-6,17,19-22,26-27H,7-16H2,1-2H3 |
| InChIKey | YSIUGVQECHLPDW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |