C29H33Cl2N5O2S — CID 142090523
2-[(2S)-2-(3,4-dichlorophenyl)-4-[2-(2,2-dimethylhydrazinyl)ethyl-methylamino]butyl]-1,5-dioxo-3,4-dihydrobenzo[g][1,4]benzothiazepine-6-carbonitrile (PubChem CID 142090523) has the molecular formula C29H33Cl2N5O2S and a molecular weight of 586.59 g/mol. Its IUPAC name is 2-[(2S)-2-(3,4-dichlorophenyl)-4-[2-(2,2-dimethylhydrazinyl)ethyl-methylamino]butyl]-1,5-dioxo-3,4-dihydrobenzo[g][1,4]benzothiazepine-6-carbonitrile.
| Compound Name | 2-[(2S)-2-(3,4-dichlorophenyl)-4-[2-(2,2-dimethylhydrazinyl)ethyl-methylamino]butyl]-1,5-dioxo-3,4-dihydrobenzo[g][1,4]benzothiazepine-6-carbonitrile |
|---|---|
| PubChem CID | 142090523 |
| Molecular Formula | C29H33Cl2N5O2S |
| Molecular Weight | 586.59 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | 2-[(2S)-2-(3,4-dichlorophenyl)-4-[2-(2,2-dimethylhydrazinyl)ethyl-methylamino]butyl]-1,5-dioxo-3,4-dihydrobenzo[g][1,4]benzothiazepine-6-carbonitrile |
| SMILES | CN(CCNN(C)C)CC[C@H](CN1CCS(=O)c2c(C#N)cc3ccccc3c2C1=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C29H33Cl2N5O2S/c1-34(2)33-11-13-35(3)12-10-22(20-8-9-25(30)26(31)17-20)19-36-14-15-39(38)28-23(18-32)16-21-6-4-5-7-24(21)27(28)29(36)37/h4-9,16-17,22,33H,10-15,19H2,1-3H3/t22-,39?/m1/s1 |
| InChIKey | WUAVCQZZUHMRPY-DJHKVZLPSA-N |
| XLogP | 4.75 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|