C32H34Cl2N2O3 — CID 68883160
3-[(3-cyano-2-ethylnaphthalene-1-carbonyl)-[2-(3,4-dichlorophenyl)non-5-enyl]amino]propanoic acid (PubChem CID 68883160) has the molecular formula C32H34Cl2N2O3 and a molecular weight of 565.54 g/mol. Its IUPAC name is 3-[(3-cyano-2-ethylnaphthalene-1-carbonyl)-[2-(3,4-dichlorophenyl)non-5-enyl]amino]propanoic acid.
| Compound Name | 3-[(3-cyano-2-ethylnaphthalene-1-carbonyl)-[2-(3,4-dichlorophenyl)non-5-enyl]amino]propanoic acid |
|---|---|
| PubChem CID | 68883160 |
| Molecular Formula | C32H34Cl2N2O3 |
| Molecular Weight | 565.54 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 3-[(3-cyano-2-ethylnaphthalene-1-carbonyl)-[2-(3,4-dichlorophenyl)non-5-enyl]amino]propanoic acid |
| SMILES | CCCC=CCCC(CN(CCC(=O)O)C(=O)c1c(CC)c(C#N)cc2ccccc12)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C32H34Cl2N2O3/c1-3-5-6-7-8-12-24(22-14-15-28(33)29(34)19-22)21-36(17-16-30(37)38)32(39)31-26(4-2)25(20-35)18-23-11-9-10-13-27(23)31/h6-7,9-11,13-15,18-19,24H,3-5,8,12,16-17,21H2,1-2H3,(H,37,38) |
| InChIKey | GLLJNPOLBZYSQL-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.54 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|