C25H22Cl2N6O2 — CID 42618833
N-[(2S)-3-[[amino-(cyanoamino)methylidene]amino]-2-(3,4-dichlorophenyl)propyl]-3-cyano-2-methoxy-N-methylnaphthalene-1-carboxamide (PubChem CID 42618833) has the molecular formula C25H22Cl2N6O2 and a molecular weight of 509.40 g/mol. Its IUPAC name is N-[(2S)-3-[[amino-(cyanoamino)methylidene]amino]-2-(3,4-dichlorophenyl)propyl]-3-cyano-2-methoxy-N-methylnaphthalene-1-carboxamide.
| Compound Name | N-[(2S)-3-[[amino-(cyanoamino)methylidene]amino]-2-(3,4-dichlorophenyl)propyl]-3-cyano-2-methoxy-N-methylnaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 42618833 |
| Molecular Formula | C25H22Cl2N6O2 |
| Molecular Weight | 509.40 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | N-[(2S)-3-[[amino-(cyanoamino)methylidene]amino]-2-(3,4-dichlorophenyl)propyl]-3-cyano-2-methoxy-N-methylnaphthalene-1-carboxamide |
| SMILES | COc1c(C#N)cc2ccccc2c1C(=O)N(C)C[C@H](C/N=C(\N)NC#N)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H22Cl2N6O2/c1-33(13-18(12-31-25(30)32-14-29)15-7-8-20(26)21(27)10-15)24(34)22-19-6-4-3-5-16(19)9-17(11-28)23(22)35-2/h3-10,18H,12-13H2,1-2H3,(H3,30,31,32)/t18-/m0/s1 |
| InChIKey | MEGJXFFUQVMVKK-SFHVURJKSA-N |
| XLogP | 4.27 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|