C27H26Cl2N2O5 — CID 142150757
1,2-dichloro-4-methylbenzene;methyl 2-[(3-cyano-2-methoxynaphthalene-1-carbonyl)-(4-oxobutyl)amino]acetate (PubChem CID 142150757) has the molecular formula C27H26Cl2N2O5 and a molecular weight of 529.42 g/mol. Its IUPAC name is 1,2-dichloro-4-methylbenzene;methyl 2-[(3-cyano-2-methoxynaphthalene-1-carbonyl)-(4-oxobutyl)amino]acetate.
| Compound Name | 1,2-dichloro-4-methylbenzene;methyl 2-[(3-cyano-2-methoxynaphthalene-1-carbonyl)-(4-oxobutyl)amino]acetate |
|---|---|
| PubChem CID | 142150757 |
| Molecular Formula | C27H26Cl2N2O5 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 1,2-dichloro-4-methylbenzene;methyl 2-[(3-cyano-2-methoxynaphthalene-1-carbonyl)-(4-oxobutyl)amino]acetate |
| SMILES | COC(=O)CN(CCCC=O)C(=O)c1c(OC)c(C#N)cc2ccccc12.Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H20N2O5.C7H6Cl2/c1-26-17(24)13-22(9-5-6-10-23)20(25)18-16-8-4-3-7-14(16)11-15(12-21)19(18)27-2;1-5-2-3-6(8)7(9)4-5/h3-4,7-8,10-11H,5-6,9,13H2,1-2H3;2-4H,1H3 |
| InChIKey | ROZKFZABJUGTEF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|