C21H32N2O6 — CID 142090692
benzyl 2-[[2-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]acetate (PubChem CID 142090692) has the molecular formula C21H32N2O6 and a molecular weight of 408.50 g/mol. Its IUPAC name is benzyl 2-[[2-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]acetate.
| Compound Name | benzyl 2-[[2-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]acetate |
|---|---|
| PubChem CID | 142090692 |
| Molecular Formula | C21H32N2O6 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | benzyl 2-[[2-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]acetate |
| SMILES | CCCC(NC(=O)OC(C)(C)C)C(OC)C(=O)NCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H32N2O6/c1-6-10-16(23-20(26)29-21(2,3)4)18(27-5)19(25)22-13-17(24)28-14-15-11-8-7-9-12-15/h7-9,11-12,16,18H,6,10,13-14H2,1-5H3,(H,22,25)(H,23,26) |
| InChIKey | WYUWDUMPOLWBLD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |