About 5-methylhex-1-en-2-amine;molecular hydrogen
5-methylhex-1-en-2-amine;molecular hydrogen (PubChem CID 142092760) has the molecular formula C7H17N
and a molecular weight of 115.22 g/mol. Its IUPAC name is 5-methylhex-1-en-2-amine;molecular hydrogen.
Molecular Properties
| Compound Name | 5-methylhex-1-en-2-amine;molecular hydrogen |
| PubChem CID | 142092760 |
| Molecular Formula | C7H17N |
| Molecular Weight | 115.22 g/mol |
| Exact Mass | 115.14 |
| IUPAC Name | 5-methylhex-1-en-2-amine;molecular hydrogen |
| SMILES | C=C(N)CCC(C)C.[H][H] |
| InChI | InChI=1S/C7H15N.H2/c1-6(2)4-5-7(3)8;/h6H,3-5,8H2,1-2H3;1H |
| InChIKey | DJPLYVFNOGSYJR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methylhex-1-en-2-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhex-1-en-2-amine;molecular hydrogen?
The IUPAC name of 5-methylhex-1-en-2-amine;molecular hydrogen (CID 142092760) is 5-methylhex-1-en-2-amine;molecular hydrogen.
What is the SMILES notation for 5-methylhex-1-en-2-amine;molecular hydrogen?
The canonical SMILES for 5-methylhex-1-en-2-amine;molecular hydrogen is C=C(N)CCC(C)C.[H][H].
What is the InChIKey of 5-methylhex-1-en-2-amine;molecular hydrogen?
The InChIKey is DJPLYVFNOGSYJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.H2/c1-6(2)4-5-7(3)8;/h6H,3-5,8H2,1-2H3;1H.
What are the key properties of 5-methylhex-1-en-2-amine;molecular hydrogen?
5-methylhex-1-en-2-amine;molecular hydrogen has a molecular weight of 115.22 g/mol, XLogP of 2.14, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhex-1-en-2-amine;molecular hydrogen is sourced from PubChem (CID 142092760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).