C20H27ClN2O2 — CID 142098899
2-chloro-4-[[3-(dimethylamino)propyl-[(4-methoxyphenyl)methyl]amino]methyl]phenol (PubChem CID 142098899) has the molecular formula C20H27ClN2O2 and a molecular weight of 362.90 g/mol. Its IUPAC name is 2-chloro-4-[[3-(dimethylamino)propyl-[(4-methoxyphenyl)methyl]amino]methyl]phenol.
| Compound Name | 2-chloro-4-[[3-(dimethylamino)propyl-[(4-methoxyphenyl)methyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 142098899 |
| Molecular Formula | C20H27ClN2O2 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-chloro-4-[[3-(dimethylamino)propyl-[(4-methoxyphenyl)methyl]amino]methyl]phenol |
| SMILES | COc1ccc(CN(CCCN(C)C)Cc2ccc(O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H27ClN2O2/c1-22(2)11-4-12-23(14-16-5-8-18(25-3)9-6-16)15-17-7-10-20(24)19(21)13-17/h5-10,13,24H,4,11-12,14-15H2,1-3H3 |
| InChIKey | JKKLCWXVSGUAOJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |