C7H11NS — CID 142099485
(1Z,3Z)-2-(ethylideneamino)penta-1,3-diene-1-thiol (PubChem CID 142099485) has the molecular formula C7H11NS and a molecular weight of 141.24 g/mol. Its IUPAC name is (1Z,3Z)-2-(ethylideneamino)penta-1,3-diene-1-thiol.
| Compound Name | (1Z,3Z)-2-(ethylideneamino)penta-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 142099485 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | (1Z,3Z)-2-(ethylideneamino)penta-1,3-diene-1-thiol |
| SMILES | C/C=C\C(=C\S)\N=C\C |
| InChI | InChI=1S/C7H11NS/c1-3-5-7(6-9)8-4-2/h3-6,9H,1-2H3/b5-3-,7-6-,8-4+ |
| InChIKey | ZMXDEAKDYZIHNI-QFRJOCIQSA-N |
| XLogP | 2.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|