About 2-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-thiazole
2-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-thiazole (PubChem CID 142099508) has the molecular formula C7H11NS
and a molecular weight of 141.24 g/mol. Its IUPAC name is 2-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-thiazole.
Analyze 2-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-thiazole?
The IUPAC name of 2-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-thiazole (CID 142099508) is 2-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-thiazole.
What is the SMILES notation for 2-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-thiazole?
The canonical SMILES for 2-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-thiazole is C/C=C\C1=CSC(C)N1.
What is the InChIKey of 2-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-thiazole?
The InChIKey is YVQXSRJVQUTSKP-ARJAWSKDSA-N. The full InChI is InChI=1S/C7H11NS/c1-3-4-7-5-9-6(2)8-7/h3-6,8H,1-2H3/b4-3-.
What are the key properties of 2-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-thiazole?
2-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-thiazole has a molecular weight of 141.24 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-thiazole is sourced from PubChem (CID 142099508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).