C20H33FO4 — CID 142099518
(13Z)-12-fluoro-4-hydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 142099518) has the molecular formula C20H33FO4 and a molecular weight of 356.48 g/mol. Its IUPAC name is (13Z)-12-fluoro-4-hydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (13Z)-12-fluoro-4-hydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 142099518 |
| Molecular Formula | C20H33FO4 |
| Molecular Weight | 356.48 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (13Z)-12-fluoro-4-hydroxy-5,5,7,9,13-pentamethyl-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | C/C1=C/CCOC(=O)CC(O)C(C)(C)C(=O)C(C)CC(C)CCC1F |
| InChI | InChI=1S/C20H33FO4/c1-13-8-9-16(21)14(2)7-6-10-25-18(23)12-17(22)20(4,5)19(24)15(3)11-13/h7,13,15-17,22H,6,8-12H2,1-5H3/b14-7- |
| InChIKey | LTVMYSMKHHNIIZ-AUWJEWJLSA-N |
| XLogP | 4.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|