C9H19NOS — CID 142100916
(3Z)-3-ethenyl-4-methylhexa-3,5-dien-1-amine;sulfane;hydrate (PubChem CID 142100916) has the molecular formula C9H19NOS and a molecular weight of 189.32 g/mol. Its IUPAC name is (3Z)-3-ethenyl-4-methylhexa-3,5-dien-1-amine;sulfane;hydrate.
| Compound Name | (3Z)-3-ethenyl-4-methylhexa-3,5-dien-1-amine;sulfane;hydrate |
|---|---|
| PubChem CID | 142100916 |
| Molecular Formula | C9H19NOS |
| Molecular Weight | 189.32 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (3Z)-3-ethenyl-4-methylhexa-3,5-dien-1-amine;sulfane;hydrate |
| SMILES | C=C/C(C)=C(\C=C)CCN.O.S |
| InChI | InChI=1S/C9H15N.H2O.H2S/c1-4-8(3)9(5-2)6-7-10;;/h4-5H,1-2,6-7,10H2,3H3;2*1H2/b9-8+;; |
| InChIKey | LEXRNPCYSPPZEY-YEUQMBKVSA-N |
| XLogP | 1.31 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|