C10H16FN — CID 144740319
(Z,3E)-2-fluoro-3-prop-2-enylidenehept-4-en-1-amine (PubChem CID 144740319) has the molecular formula C10H16FN and a molecular weight of 169.24 g/mol. Its IUPAC name is (Z,3E)-2-fluoro-3-prop-2-enylidenehept-4-en-1-amine.
| Compound Name | (Z,3E)-2-fluoro-3-prop-2-enylidenehept-4-en-1-amine |
|---|---|
| PubChem CID | 144740319 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | (Z,3E)-2-fluoro-3-prop-2-enylidenehept-4-en-1-amine |
| SMILES | C=C/C=C(\C=C/CC)C(F)CN |
| InChI | InChI=1S/C10H16FN/c1-3-5-7-9(6-4-2)10(11)8-12/h4-7,10H,2-3,8,12H2,1H3/b7-5-,9-6+ |
| InChIKey | YXFPDFWFKIBKHD-XCZNYUDNSA-N |
| XLogP | 2.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|