C11H14S2 — CID 142100989
2-methyl-5-[[(2Z)-penta-2,4-dienyl]sulfanylmethyl]thiophene (PubChem CID 142100989) has the molecular formula C11H14S2 and a molecular weight of 210.37 g/mol. Its IUPAC name is 2-methyl-5-[[(2Z)-penta-2,4-dienyl]sulfanylmethyl]thiophene.
| Compound Name | 2-methyl-5-[[(2Z)-penta-2,4-dienyl]sulfanylmethyl]thiophene |
|---|---|
| PubChem CID | 142100989 |
| Molecular Formula | C11H14S2 |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 2-methyl-5-[[(2Z)-penta-2,4-dienyl]sulfanylmethyl]thiophene |
| SMILES | C=C/C=C\CSCc1ccc(C)s1 |
| InChI | InChI=1S/C11H14S2/c1-3-4-5-8-12-9-11-7-6-10(2)13-11/h3-7H,1,8-9H2,2H3/b5-4- |
| InChIKey | YZEKLBRWBNERJP-PLNGDYQASA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|