C16H26N2 — CID 142101442
2-tert-butyl-6,6,8-trimethyl-2,3,4,9-tetrahydropyrido[2,3-b]azepine (PubChem CID 142101442) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 2-tert-butyl-6,6,8-trimethyl-2,3,4,9-tetrahydropyrido[2,3-b]azepine.
| Compound Name | 2-tert-butyl-6,6,8-trimethyl-2,3,4,9-tetrahydropyrido[2,3-b]azepine |
|---|---|
| PubChem CID | 142101442 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 2-tert-butyl-6,6,8-trimethyl-2,3,4,9-tetrahydropyrido[2,3-b]azepine |
| SMILES | CC1=CC(C)(C)C=C2CCC(C(C)(C)C)N=C2N1 |
| InChI | InChI=1S/C16H26N2/c1-11-9-16(5,6)10-12-7-8-13(15(2,3)4)18-14(12)17-11/h9-10,13H,7-8H2,1-6H3,(H,17,18) |
| InChIKey | WOWNWQDZPDSTJB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |