C20H20N2 — CID 176536757
2-cyclohepta-1,3,4,6-tetraen-1-yl-4-[(4Z)-cycloocta-1,2,4-trien-1-yl]-6-methyl-1,4-dihydropyrimidine (PubChem CID 176536757) has the molecular formula C20H20N2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-cyclohepta-1,3,4,6-tetraen-1-yl-4-[(4Z)-cycloocta-1,2,4-trien-1-yl]-6-methyl-1,4-dihydropyrimidine.
| Compound Name | 2-cyclohepta-1,3,4,6-tetraen-1-yl-4-[(4Z)-cycloocta-1,2,4-trien-1-yl]-6-methyl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 176536757 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-cyclohepta-1,3,4,6-tetraen-1-yl-4-[(4Z)-cycloocta-1,2,4-trien-1-yl]-6-methyl-1,4-dihydropyrimidine |
| SMILES | CC1=CC(C2=C=C/C=C\CCC2)N=C(C2=CC=C=CC=C2)N1 |
| InChI | InChI=1S/C20H20N2/c1-16-15-19(17-11-7-3-2-4-8-12-17)22-20(21-16)18-13-9-5-6-10-14-18/h2-3,5,7,9-10,13-15,19H,4,8,12H2,1H3,(H,21,22)/b3-2- |
| InChIKey | LTWIIQWNFAURTO-IHWYPQMZSA-N |
| XLogP | 4.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |