C7H9Br3O2 — CID 142103804
[(E)-1,2,4-tribromo-3-methylpent-3-en-2-yl] formate (PubChem CID 142103804) has the molecular formula C7H9Br3O2 and a molecular weight of 364.86 g/mol. Its IUPAC name is [(E)-1,2,4-tribromo-3-methylpent-3-en-2-yl] formate.
| Compound Name | [(E)-1,2,4-tribromo-3-methylpent-3-en-2-yl] formate |
|---|---|
| PubChem CID | 142103804 |
| Molecular Formula | C7H9Br3O2 |
| Molecular Weight | 364.86 g/mol |
| Exact Mass | 361.82 |
| IUPAC Name | [(E)-1,2,4-tribromo-3-methylpent-3-en-2-yl] formate |
| SMILES | C/C(Br)=C(/C)C(Br)(CBr)OC=O |
| InChI | InChI=1S/C7H9Br3O2/c1-5(6(2)9)7(10,3-8)12-4-11/h4H,3H2,1-2H3/b6-5+ |
| InChIKey | XMXSVMALRJKQTJ-AATRIKPKSA-N |
| XLogP | 3.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.86 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|