About tert-butyl formate;methanamine;4-methoxybutan-2-one
tert-butyl formate;methanamine;4-methoxybutan-2-one (PubChem CID 163253755) has the molecular formula C11H25NO4
and a molecular weight of 235.32 g/mol. Its IUPAC name is tert-butyl formate;methanamine;4-methoxybutan-2-one.
Molecular Properties
| Compound Name | tert-butyl formate;methanamine;4-methoxybutan-2-one |
| PubChem CID | 163253755 |
| Molecular Formula | C11H25NO4 |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | tert-butyl formate;methanamine;4-methoxybutan-2-one |
| SMILES | CC(C)(C)OC=O.CN.COCCC(C)=O |
| InChI | InChI=1S/2C5H10O2.CH5N/c1-5(2,3)7-4-6;1-5(6)3-4-7-2;1-2/h4H,1-3H3;3-4H2,1-2H3;2H2,1H3 |
| InChIKey | BZPMYCSYJZIRMO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;methanamine;4-methoxybutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;methanamine;4-methoxybutan-2-one?
The IUPAC name of tert-butyl formate;methanamine;4-methoxybutan-2-one (CID 163253755) is tert-butyl formate;methanamine;4-methoxybutan-2-one.
What is the SMILES notation for tert-butyl formate;methanamine;4-methoxybutan-2-one?
The canonical SMILES for tert-butyl formate;methanamine;4-methoxybutan-2-one is CC(C)(C)OC=O.CN.COCCC(C)=O.
What is the InChIKey of tert-butyl formate;methanamine;4-methoxybutan-2-one?
The InChIKey is BZPMYCSYJZIRMO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H10O2.CH5N/c1-5(2,3)7-4-6;1-5(6)3-4-7-2;1-2/h4H,1-3H3;3-4H2,1-2H3;2H2,1H3.
What are the key properties of tert-butyl formate;methanamine;4-methoxybutan-2-one?
tert-butyl formate;methanamine;4-methoxybutan-2-one has a molecular weight of 235.32 g/mol, XLogP of 1.14, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;methanamine;4-methoxybutan-2-one is sourced from PubChem (CID 163253755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).