C11H20O — CID 142105657
(4Z,6E)-7,8-dimethylnona-4,6-dien-2-ol (PubChem CID 142105657) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (4Z,6E)-7,8-dimethylnona-4,6-dien-2-ol.
| Compound Name | (4Z,6E)-7,8-dimethylnona-4,6-dien-2-ol |
|---|---|
| PubChem CID | 142105657 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (4Z,6E)-7,8-dimethylnona-4,6-dien-2-ol |
| SMILES | C/C(=C\C=C/CC(C)O)C(C)C |
| InChI | InChI=1S/C11H20O/c1-9(2)10(3)7-5-6-8-11(4)12/h5-7,9,11-12H,8H2,1-4H3/b6-5-,10-7+ |
| InChIKey | IZLZEOPNDSQWAN-ZZWPSLBBSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|